cas: 101-85-9 — see every product listed under this CAS number, including other names
2-Benzylideneheptan-1-ol, 96%, 96% (CAS 101-85-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1114FR-100mg |
| cas | 101-85-9 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 558.80 Pln | |
| Chemat | 10g | 890.00 Pln | |
| Chemat | 25g | 1782.80 Pln | |
| Chemat | 50g | 2819.60 Pln | |
| Chemat | 100g | 4197.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
(2Z)-2-benzylideneheptan-1-ol (CAS 101-85-9) is a chemical compound with the molecular formula C14H20O and a molecular weight of 204.31 g/mol. IUPAC name: (2Z)-2-benzylideneheptan-1-ol. InChIKey: LIPHCKNQPJXUQF-KAMYIIQDSA-N.
| Molecular formula | C14H20O |
|---|---|
| Molecular weight | 204.31 g/mol |
| IUPAC name | (2Z)-2-benzylideneheptan-1-ol |
| InChIKey | LIPHCKNQPJXUQF-KAMYIIQDSA-N |
| SMILES | CCCCC/C(=C/C1=CC=CC=C1)/CO |
Computed by PubChem (NCBI)