cas: 200956-91-8 — see every product listed under this CAS number, including other names
2-Benzyloxy-5-(trifluoromethoxy)benzene, 98%, 98% (CAS 200956-91-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch132QDV-100mg |
| cas | 200956-91-8 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 688.40 Pln | |
| Chemat | 10g | 1115.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-phenylmethoxy-4-(trifluoromethoxy)benzene (CAS 200956-91-8) is a chemical compound with the molecular formula C14H11F3O2 and a molecular weight of 268.23 g/mol. IUPAC name: 1-phenylmethoxy-4-(trifluoromethoxy)benzene. InChIKey: DLBIMYYCJAYTRS-UHFFFAOYSA-N.
| Molecular formula | C14H11F3O2 |
|---|---|
| Molecular weight | 268.23 g/mol |
| IUPAC name | 1-phenylmethoxy-4-(trifluoromethoxy)benzene |
| InChIKey | DLBIMYYCJAYTRS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)OC(F)(F)F |
Computed by PubChem (NCBI)