CAS 70783-33-4 is the registry number for 2,2,2-Trifluoro-1-(4-phenoxyphenyl)ethanol, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,2-trifluoro-1-(4-phenoxyphenyl)ethanol (CAS 70783-33-4) is a chemical compound with the molecular formula C14H11F3O2 and a molecular weight of 268.23 g/mol. IUPAC name: 2,2,2-trifluoro-1-(4-phenoxyphenyl)ethanol. InChIKey: NNULRJTXYWIUCM-UHFFFAOYSA-N.
| Molecular formula | C14H11F3O2 |
|---|---|
| Molecular weight | 268.23 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(4-phenoxyphenyl)ethanol |
| InChIKey | NNULRJTXYWIUCM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)C(C(F)(F)F)O |
Computed by PubChem (NCBI)