CAS 2379321-37-4 is the registry number for (4-(Trifluoromethoxy)-[1,1'-biphenyl]-2-yl)methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
[2-phenyl-5-(trifluoromethoxy)phenyl]methanol (CAS 2379321-37-4) is a chemical compound with the molecular formula C14H11F3O2 and a molecular weight of 268.23 g/mol. IUPAC name: [2-phenyl-5-(trifluoromethoxy)phenyl]methanol. InChIKey: BYFMIZBIIQTPBE-UHFFFAOYSA-N.
| Molecular formula | C14H11F3O2 |
|---|---|
| Molecular weight | 268.23 g/mol |
| IUPAC name | [2-phenyl-5-(trifluoromethoxy)phenyl]methanol |
| InChIKey | BYFMIZBIIQTPBE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=C(C=C2)OC(F)(F)F)CO |
Computed by PubChem (NCBI)