CAS 1261990-39-9 appears in our catalog under these names: 2-Methoxy-4-(3-trifluoromethylphenyl)phenol, 98%, 3-Methoxy-3'-(trifluoromethyl)-(1,1'-biphenyl)-4-ol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
2-methoxy-4-[3-(trifluoromethyl)phenyl]phenol (CAS 1261990-39-9) is a chemical compound with the molecular formula C14H11F3O2 and a molecular weight of 268.23 g/mol. IUPAC name: 2-methoxy-4-[3-(trifluoromethyl)phenyl]phenol. InChIKey: JLYWAKRLNWYLIC-UHFFFAOYSA-N.
| Molecular formula | C14H11F3O2 |
|---|---|
| Molecular weight | 268.23 g/mol |
| IUPAC name | 2-methoxy-4-[3-(trifluoromethyl)phenyl]phenol |
| InChIKey | JLYWAKRLNWYLIC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C2=CC(=CC=C2)C(F)(F)F)O |
Computed by PubChem (NCBI)