cas: 105242-10-2 — see every product listed under this CAS number, including other names
2-Biphenyl-4-yl-piperazine, 98+% (CAS 105242-10-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A149346-5g |
| cas | 105242-10-2 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 5147.80 Pln | |
| AmBeed | 250mg | 577.78 Pln | |
| AmBeed | 10g | 7595.56 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(4-phenylphenyl)piperazine (CAS 105242-10-2) is a chemical compound with the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. IUPAC name: 2-(4-phenylphenyl)piperazine. InChIKey: QUINYTMXFWCKTN-UHFFFAOYSA-N.
| Molecular formula | C16H18N2 |
|---|---|
| Molecular weight | 238.33 g/mol |
| IUPAC name | 2-(4-phenylphenyl)piperazine |
| InChIKey | QUINYTMXFWCKTN-UHFFFAOYSA-N |
| SMILES | C1CNC(CN1)C2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)