CAS 29418-36-8 is the registry number for Eltrombopag Impurity 24. Offered by: Chemat Brand. Available pack sizes: on request.
Bis(3,4-dimethylphenyl)diazene (CAS 29418-36-8) is a chemical compound with the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. IUPAC name: bis(3,4-dimethylphenyl)diazene. InChIKey: WEVSWJHEFVKUSR-UHFFFAOYSA-N.
| Molecular formula | C16H18N2 |
|---|---|
| Molecular weight | 238.33 g/mol |
| IUPAC name | bis(3,4-dimethylphenyl)diazene |
| InChIKey | WEVSWJHEFVKUSR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N=NC2=CC(=C(C=C2)C)C)C |
Computed by PubChem (NCBI)