CAS 81601-99-2 is the registry number for Cis-2,3-diphenylpiperazine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg.
(2R,3S)-2,3-diphenylpiperazine (CAS 81601-99-2) is a chemical compound with the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. IUPAC name: (2R,3S)-2,3-diphenylpiperazine. InChIKey: NXYCTQXWYWRZDE-IYBDPMFKSA-N.
| Molecular formula | C16H18N2 |
|---|---|
| Molecular weight | 238.33 g/mol |
| IUPAC name | (2R,3S)-2,3-diphenylpiperazine |
| InChIKey | NXYCTQXWYWRZDE-IYBDPMFKSA-N |
| SMILES | C1CN[C@@H]([C@@H](N1)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)