CAS 22525-43-5 appears in our catalog under these names: 4-Amino-4'-(n,n-dimethylamino)stilbene, 95%, 4–Amino–4'–(N,N–dimethylamino)stilbene, 4-Amino-4'-(N,N-dimethylamino)stilbene, >98.0%(T), 4-(4-Aminostyryl)-N,N-dimethylaniline, 97%(GC-MS),RG, 97%(GC-MS),RG. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg.
4-[2-[4-(dimethylamino)phenyl]ethenyl]aniline (CAS 22525-43-5) is a chemical compound with the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. IUPAC name: 4-[2-[4-(dimethylamino)phenyl]ethenyl]aniline. InChIKey: GCHSJPKVJSMRDX-UHFFFAOYSA-N.
| Molecular formula | C16H18N2 |
|---|---|
| Molecular weight | 238.33 g/mol |
| IUPAC name | 4-[2-[4-(dimethylamino)phenyl]ethenyl]aniline |
| InChIKey | GCHSJPKVJSMRDX-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C=CC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)