cas: 869976-20-5 — see every product listed under this CAS number, including other names
2-Boc-2,8-Diazaspiro(4.5)decane hydrochloride, 98% (CAS 869976-20-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A951048-5g |
| cas | 869976-20-5 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 9210.04 Pln | |
| AmBeed | 1g | 3116.68 Pln | |
| AmBeed | 250mg | 1274.35 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl 2,8-diazaspiro[4.5]decane-2-carboxylate;hydrochloride (CAS 869976-20-5) is a chemical compound with the molecular formula C13H25ClN2O2 and a molecular weight of 276.80 g/mol. IUPAC name: tert-butyl 2,8-diazaspiro[4.5]decane-2-carboxylate;hydrochloride. InChIKey: KNIAXYMLCVFVTK-UHFFFAOYSA-N.
| Molecular formula | C13H25ClN2O2 |
|---|---|
| Molecular weight | 276.80 g/mol |
| IUPAC name | tert-butyl 2,8-diazaspiro[4.5]decane-2-carboxylate;hydrochloride |
| InChIKey | KNIAXYMLCVFVTK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)CCNCC2.Cl |
Computed by PubChem (NCBI)