cas: 874290-67-2 — see every product listed under this CAS number, including other names
2-Borono-4-chlorobenzoic acid 98% (CAS 874290-67-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A372610-100mg |
| cas | 874290-67-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 286.94 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 620.69 Pln | |
| Ambeed | 5g | 2061.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A372610 |
2-borono-4-chlorobenzoic acid (CAS 874290-67-2) is a chemical compound with the molecular formula C7H6BClO4 and a molecular weight of 200.38 g/mol. IUPAC name: 2-borono-4-chlorobenzoic acid. InChIKey: OTIPTCHUAWBCTA-UHFFFAOYSA-N.
| Molecular formula | C7H6BClO4 |
|---|---|
| Molecular weight | 200.38 g/mol |
| IUPAC name | 2-borono-4-chlorobenzoic acid |
| InChIKey | OTIPTCHUAWBCTA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Cl)C(=O)O)(O)O |
Computed by PubChem (NCBI)