2-Borono-4-chlorobenzoic acid, 98%
cas: 874290-67-2 — see every product listed under this CAS number, including other names
2-Borono-4-chlorobenzoic acid, 98% (CAS 874290-67-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F215869-100MG |
| cas | 874290-67-2 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 331.15 Pln | |
| Fluorochem | 250mg | 508.17 Pln | |
| Fluorochem | 1g | 1216.26 Pln | |
| Fluorochem | 5g | 4543.21 Pln | |
| Ambeed | 100mg | 264.69 Pln | |
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 565.06 Pln | |
| Ambeed | 5g | 1877.81 Pln | |
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 352.40 Pln | |
| Chemat | 1g | 837.20 Pln | |
| Chemat | 5g | 3165.20 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
2-borono-4-chlorobenzoic acid (CAS 874290-67-2) is a chemical compound with the molecular formula C7H6BClO4 and a molecular weight of 200.38 g/mol. IUPAC name: 2-borono-4-chlorobenzoic acid. InChIKey: OTIPTCHUAWBCTA-UHFFFAOYSA-N.
| Molecular formula | C7H6BClO4 |
|---|---|
| Molecular weight | 200.38 g/mol |
| IUPAC name | 2-borono-4-chlorobenzoic acid |
| InChIKey | OTIPTCHUAWBCTA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Cl)C(=O)O)(O)O |
Computed by PubChem (NCBI)