2-Borono-4-chlorobenzoic acid, 98%
cas: 874290-67-2 — see every product listed under this CAS number, including other names
2-Borono-4-chlorobenzoic acid, 98% (CAS 874290-67-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F215869-100MG |
| cas | 874290-67-2 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 1153.78 Pln | |
| Fluorochem | 5g | 4381.81 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-borono-4-chlorobenzoic acid (CAS 874290-67-2) is a chemical compound with the molecular formula C7H6BClO4 and a molecular weight of 200.38 g/mol. IUPAC name: 2-borono-4-chlorobenzoic acid. InChIKey: OTIPTCHUAWBCTA-UHFFFAOYSA-N.
| Molecular formula | C7H6BClO4 |
|---|---|
| Molecular weight | 200.38 g/mol |
| IUPAC name | 2-borono-4-chlorobenzoic acid |
| InChIKey | OTIPTCHUAWBCTA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Cl)C(=O)O)(O)O |
Computed by PubChem (NCBI)