cas: 1484-50-0 — see every product listed under this CAS number, including other names
2-Bromo-1,2-diphenylethanone, 98%(HPLC),RG, 98%(HPLC),RG (CAS 1484-50-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112KWQ-1g |
| cas | 1484-50-0 |
| size | 1g |
| availability | 400g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 520.40 Pln | |
| Chemat | 25g | 1662.80 Pln | |
| Chemat | 100g | 6376.40 Pln |
| purity | 98%(HPLC),RG |
|---|---|
| delivery time | 3 weeks |
2-bromo-1,2-diphenylethanone (CAS 1484-50-0) is a chemical compound with the molecular formula C14H11BrO and a molecular weight of 275.14 g/mol. IUPAC name: 2-bromo-1,2-diphenylethanone. InChIKey: ZFFBIQMNKOJDJE-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO |
|---|---|
| Molecular weight | 275.14 g/mol |
| IUPAC name | 2-bromo-1,2-diphenylethanone |
| InChIKey | ZFFBIQMNKOJDJE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)C2=CC=CC=C2)Br |
Computed by PubChem (NCBI)