cas: 6096-83-9 — see every product listed under this CAS number, including other names
2-Bromo-1-(3-bromo-4-methoxyphenyl)ethanone (CAS 6096-83-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F015346-100MG |
| cas | 6096-83-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 279.09 Pln | |
| Fluorochem | 250mg | 315.53 Pln | |
| Fluorochem | 1g | 1013.20 Pln | |
| Fluorochem | 5g | 3371.75 Pln |
| delivery time | 2-3 weeks |
|---|
2-bromo-1-(3-bromo-4-methoxyphenyl)ethanone (CAS 6096-83-9) is a chemical compound with the molecular formula C9H8Br2O2 and a molecular weight of 307.97 g/mol. IUPAC name: 2-bromo-1-(3-bromo-4-methoxyphenyl)ethanone. InChIKey: UAHYADIIIVEZIK-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2O2 |
|---|---|
| Molecular weight | 307.97 g/mol |
| IUPAC name | 2-bromo-1-(3-bromo-4-methoxyphenyl)ethanone |
| InChIKey | UAHYADIIIVEZIK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)CBr)Br |
Computed by PubChem (NCBI)