CAS 1214375-69-5 appears in our catalog under these names: Ethyl 2,6-dibromobenzoate, 95%, Ethyl 2,6-dibromobenzoate, 95+%, 2,6-Dibromobenzoic acid ethyl ester, ≥95%, ≥95%, 2,6-Dibromobenzoic acid ethyl ester. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
Ethyl 2,6-dibromobenzoate (CAS 1214375-69-5) is a chemical compound with the molecular formula C9H8Br2O2 and a molecular weight of 307.97 g/mol. IUPAC name: ethyl 2,6-dibromobenzoate. InChIKey: AEBVQYCWIHYSEA-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2O2 |
|---|---|
| Molecular weight | 307.97 g/mol |
| IUPAC name | ethyl 2,6-dibromobenzoate |
| InChIKey | AEBVQYCWIHYSEA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC=C1Br)Br |
Computed by PubChem (NCBI)