CAS 139194-78-8 appears in our catalog under these names: 2-(2,5-Dibromophenyl)-1,3-dioxolane, 97%, 2-(2,5-Dibromophenyl)-1,3-dioxolane, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
2-(2,5-dibromophenyl)-1,3-dioxolane (CAS 139194-78-8) is a chemical compound with the molecular formula C9H8Br2O2 and a molecular weight of 307.97 g/mol. IUPAC name: 2-(2,5-dibromophenyl)-1,3-dioxolane. InChIKey: BRLACMTYMHWMFY-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2O2 |
|---|---|
| Molecular weight | 307.97 g/mol |
| IUPAC name | 2-(2,5-dibromophenyl)-1,3-dioxolane |
| InChIKey | BRLACMTYMHWMFY-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C=CC(=C2)Br)Br |
Computed by PubChem (NCBI)