CAS 203314-32-3 is the registry number for methyl 2-(2,5-dibromophenyl)acetate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g.
Methyl 2-(2,5-dibromophenyl)acetate (CAS 203314-32-3) is a chemical compound with the molecular formula C9H8Br2O2 and a molecular weight of 307.97 g/mol. IUPAC name: methyl 2-(2,5-dibromophenyl)acetate. InChIKey: ANQBKHYHXLHLSQ-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2O2 |
|---|---|
| Molecular weight | 307.97 g/mol |
| IUPAC name | methyl 2-(2,5-dibromophenyl)acetate |
| InChIKey | ANQBKHYHXLHLSQ-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=C(C=CC(=C1)Br)Br |
Computed by PubChem (NCBI)