Products 203314-32-3

CAS 203314-32-3 is the registry number for methyl 2-(2,5-dibromophenyl)acetate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g.

Structural formula: {0} (CAS {1})

Methyl 2-(2,5-dibromophenyl)acetate (CAS 203314-32-3) is a chemical compound with the molecular formula C9H8Br2O2 and a molecular weight of 307.97 g/mol. IUPAC name: methyl 2-(2,5-dibromophenyl)acetate. InChIKey: ANQBKHYHXLHLSQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8Br2O2
Molecular weight307.97 g/mol
IUPAC namemethyl 2-(2,5-dibromophenyl)acetate
InChIKeyANQBKHYHXLHLSQ-UHFFFAOYSA-N
SMILESCOC(=O)CC1=C(C=CC(=C1)Br)Br

Computed by PubChem (NCBI)