cas: 19128-48-4 — see every product listed under this CAS number, including other names
2-Bromo-1-chloro-3-nitrobenzene, 95% (CAS 19128-48-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F222660-1G |
| cas | 19128-48-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 10g | 154.13 Pln | |
| Fluorochem | 25g | 284.29 Pln | |
| Fluorochem | 500g | 4574.45 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-bromo-1-chloro-3-nitrobenzene (CAS 19128-48-4) is a chemical compound with the molecular formula C6H3BrClNO2 and a molecular weight of 236.45 g/mol. IUPAC name: 2-bromo-1-chloro-3-nitrobenzene. InChIKey: UYTRBIUOIKOGQO-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClNO2 |
|---|---|
| Molecular weight | 236.45 g/mol |
| IUPAC name | 2-bromo-1-chloro-3-nitrobenzene |
| InChIKey | UYTRBIUOIKOGQO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)