CAS 530156-90-2 appears in our catalog under these names: 2-Bromo-5-chloroisonicotinic acid, 97%, 2-Bromo-5-chloroisonicotinic acid 95%, 2-Bromo-5-chloroisonicotinic acid, 95%, 4-Pyridinecarboxylic acid, 2-bromo-5-chloro-, 97%, 97%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 5g, 25g, 1g, 250mg, 10g, 100mg.
2-bromo-5-chloropyridine-4-carboxylic acid (CAS 530156-90-2) is a chemical compound with the molecular formula C6H3BrClNO2 and a molecular weight of 236.45 g/mol. IUPAC name: 2-bromo-5-chloropyridine-4-carboxylic acid. InChIKey: DUOLMMJBAYMNEL-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClNO2 |
|---|---|
| Molecular weight | 236.45 g/mol |
| IUPAC name | 2-bromo-5-chloropyridine-4-carboxylic acid |
| InChIKey | DUOLMMJBAYMNEL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Br)Cl)C(=O)O |
Computed by PubChem (NCBI)