cas: 454-78-4 — see every product listed under this CAS number, including other names
2-Bromo-1-chloro-4-(trifluoromethyl)benzene 97% (CAS 454-78-4) is a chemical reagent available from Chemat. Available pack sizes: 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A299160-100g |
| cas | 454-78-4 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 220.19 Pln | |
| Ambeed | 500g | 615.13 Pln | |
| Ambeed | 1000g | 1149.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A299160 |
2-bromo-1-chloro-4-(trifluoromethyl)benzene (CAS 454-78-4) is a chemical compound with the molecular formula C7H3BrClF3 and a molecular weight of 259.45 g/mol. IUPAC name: 2-bromo-1-chloro-4-(trifluoromethyl)benzene. InChIKey: APSISOSWYXCEQX-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClF3 |
|---|---|
| Molecular weight | 259.45 g/mol |
| IUPAC name | 2-bromo-1-chloro-4-(trifluoromethyl)benzene |
| InChIKey | APSISOSWYXCEQX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Br)Cl |
Computed by PubChem (NCBI)