cas: 454-78-4 — see every product listed under this CAS number, including other names
3-Bromo-4-chlorobenzotrifluoride, 97% (CAS 454-78-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F010672-1G |
| cas | 454-78-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 81.24 Pln | |
| Fluorochem | 100g | 190.58 Pln | |
| Fluorochem | 500g | 419.66 Pln | |
| Fluorochem | 1kg | 778.91 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 97% |
2-bromo-1-chloro-4-(trifluoromethyl)benzene (CAS 454-78-4) is a chemical compound with the molecular formula C7H3BrClF3 and a molecular weight of 259.45 g/mol. IUPAC name: 2-bromo-1-chloro-4-(trifluoromethyl)benzene. InChIKey: APSISOSWYXCEQX-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClF3 |
|---|---|
| Molecular weight | 259.45 g/mol |
| IUPAC name | 2-bromo-1-chloro-4-(trifluoromethyl)benzene |
| InChIKey | APSISOSWYXCEQX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Br)Cl |
Computed by PubChem (NCBI)