cas: 959961-65-0 — see every product listed under this CAS number, including other names
2-Bromo-1-fluoro-4-methanesulfonylbenzene, 95%, 95% (CAS 959961-65-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IJPQ-100mg |
| cas | 959961-65-0 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 563.60 Pln | |
| Chemat | 250mg | 909.20 Pln | |
| Chemat | 1g | 1806.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-bromo-1-fluoro-4-methylsulfonylbenzene (CAS 959961-65-0) is a chemical compound with the molecular formula C7H6BrFO2S and a molecular weight of 253.09 g/mol. IUPAC name: 2-bromo-1-fluoro-4-methylsulfonylbenzene. InChIKey: LVCOOUAQCQKOJG-UHFFFAOYSA-N.
| Molecular formula | C7H6BrFO2S |
|---|---|
| Molecular weight | 253.09 g/mol |
| IUPAC name | 2-bromo-1-fluoro-4-methylsulfonylbenzene |
| InChIKey | LVCOOUAQCQKOJG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)F)Br |
Computed by PubChem (NCBI)