Products 2137744-08-0

CAS 2137744-08-0 is the registry number for 5-Bromo-2-methylbenzenesulfonyl fluoride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.

5-bromo-2-methylbenzenesulfonyl fluoride (CAS 2137744-08-0) is a chemical compound with the molecular formula C7H6BrFO2S and a molecular weight of 253.09 g/mol. IUPAC name: 5-bromo-2-methylbenzenesulfonyl fluoride. InChIKey: VNOQIUNFKBJTEN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6BrFO2S
Molecular weight253.09 g/mol
IUPAC name5-bromo-2-methylbenzenesulfonyl fluoride
InChIKeyVNOQIUNFKBJTEN-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)Br)S(=O)(=O)F

Computed by PubChem (NCBI)