CAS 1030832-29-1 appears in our catalog under these names: 4-Bromo-3-methylbenzenesulfonyl fluoride, 95%, 4-Bromo-3-methylbenzene-1-sulfonyl fluoride 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 10g, 5g, 1g, 250mg.
4-bromo-3-methylbenzenesulfonyl fluoride (CAS 1030832-29-1) is a chemical compound with the molecular formula C7H6BrFO2S and a molecular weight of 253.09 g/mol. IUPAC name: 4-bromo-3-methylbenzenesulfonyl fluoride. InChIKey: MFTYFZJCYYEADZ-UHFFFAOYSA-N.
| Molecular formula | C7H6BrFO2S |
|---|---|
| Molecular weight | 253.09 g/mol |
| IUPAC name | 4-bromo-3-methylbenzenesulfonyl fluoride |
| InChIKey | MFTYFZJCYYEADZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)S(=O)(=O)F)Br |
Computed by PubChem (NCBI)