CAS 648904-84-1 is the registry number for 4-Bromo-2-fluoro-1-(methylsulfonyl)benzene, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-bromo-2-fluoro-1-methylsulfonylbenzene (CAS 648904-84-1) is a chemical compound with the molecular formula C7H6BrFO2S and a molecular weight of 253.09 g/mol. IUPAC name: 4-bromo-2-fluoro-1-methylsulfonylbenzene. InChIKey: ISSNNKYYINPTHS-UHFFFAOYSA-N.
| Molecular formula | C7H6BrFO2S |
|---|---|
| Molecular weight | 253.09 g/mol |
| IUPAC name | 4-bromo-2-fluoro-1-methylsulfonylbenzene |
| InChIKey | ISSNNKYYINPTHS-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=C(C=C1)Br)F |
Computed by PubChem (NCBI)