cas: 1805138-23-1 — see every product listed under this CAS number, including other names
2-Bromo-3-Chloro-4-Nitropyridine, 97%, 97% (CAS 1805138-23-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I14H-100mg |
| cas | 1805138-23-1 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 222.80 Pln | |
| Chemat | 250mg | 429.20 Pln | |
| Chemat | 500mg | 760.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-bromo-3-chloro-4-nitropyridine (CAS 1805138-23-1) is a chemical compound with the molecular formula C5H2BrClN2O2 and a molecular weight of 237.44 g/mol. IUPAC name: 2-bromo-3-chloro-4-nitropyridine. InChIKey: ISDWIGKURABZNN-UHFFFAOYSA-N.
| Molecular formula | C5H2BrClN2O2 |
|---|---|
| Molecular weight | 237.44 g/mol |
| IUPAC name | 2-bromo-3-chloro-4-nitropyridine |
| InChIKey | ISDWIGKURABZNN-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1[N+](=O)[O-])Cl)Br |
Computed by PubChem (NCBI)