CAS 1082041-27-7 appears in our catalog under these names: 2-Chloro-4-nitro-5-bromopyridine, 95%, 5-Bromo-2-chloro-4-nitropyridine, 95%, 5-Bromo-2-chloro-4-nitropyridine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 2,5g, 250mg.
5-bromo-2-chloro-4-nitropyridine (CAS 1082041-27-7) is a chemical compound with the molecular formula C5H2BrClN2O2 and a molecular weight of 237.44 g/mol. IUPAC name: 5-bromo-2-chloro-4-nitropyridine. InChIKey: WXOVZVORCQADFC-UHFFFAOYSA-N.
| Molecular formula | C5H2BrClN2O2 |
|---|---|
| Molecular weight | 237.44 g/mol |
| IUPAC name | 5-bromo-2-chloro-4-nitropyridine |
| InChIKey | WXOVZVORCQADFC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)