Products 1500866-49-8

CAS 1500866-49-8 is the registry number for 6-Bromo-3-chloropyridazine-4-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

6-bromo-3-chloropyridazine-4-carboxylic acid (CAS 1500866-49-8) is a chemical compound with the molecular formula C5H2BrClN2O2 and a molecular weight of 237.44 g/mol. IUPAC name: 6-bromo-3-chloropyridazine-4-carboxylic acid. InChIKey: QAISNUYMGOYPRG-UHFFFAOYSA-N.

Identity
Molecular formulaC5H2BrClN2O2
Molecular weight237.44 g/mol
IUPAC name6-bromo-3-chloropyridazine-4-carboxylic acid
InChIKeyQAISNUYMGOYPRG-UHFFFAOYSA-N
SMILESC1=C(C(=NN=C1Br)Cl)C(=O)O

Computed by PubChem (NCBI)