cas: 1003043-31-9 — see every product listed under this CAS number, including other names
2-Bromo-3-chloropyridine-4-boronic acid, 95% (CAS 1003043-31-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F218930-1G |
| cas | 1003043-31-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 284.29 Pln | |
| Fluorochem | 5g | 997.58 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2-bromo-3-chloro-4-pyridinyl)boronic acid (CAS 1003043-31-9) is a chemical compound with the molecular formula C5H4BBrClNO2 and a molecular weight of 236.26 g/mol. IUPAC name: (2-bromo-3-chloro-4-pyridinyl)boronic acid. InChIKey: XBFYDECHVMPQHV-UHFFFAOYSA-N.
| Molecular formula | C5H4BBrClNO2 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | (2-bromo-3-chloro-4-pyridinyl)boronic acid |
| InChIKey | XBFYDECHVMPQHV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=NC=C1)Br)Cl)(O)O |
Computed by PubChem (NCBI)