Products 957062-85-0

CAS 957062-85-0 is the registry number for 4-Bromo-6-chloropyridine-3-boronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

(4-bromo-6-chloro-3-pyridinyl)boronic acid (CAS 957062-85-0) is a chemical compound with the molecular formula C5H4BBrClNO2 and a molecular weight of 236.26 g/mol. IUPAC name: (4-bromo-6-chloro-3-pyridinyl)boronic acid. InChIKey: LFWCFEIUOQWFAY-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4BBrClNO2
Molecular weight236.26 g/mol
IUPAC name(4-bromo-6-chloro-3-pyridinyl)boronic acid
InChIKeyLFWCFEIUOQWFAY-UHFFFAOYSA-N
SMILESB(C1=CN=C(C=C1Br)Cl)(O)O

Computed by PubChem (NCBI)