CAS 1072944-16-1 appears in our catalog under these names: 3-Bromo-2-chloropyridine-4-boronic acid, 98%, (3-Bromo-2-chloropyridin-4-yl)boronic acid 98%, 3-Bromo-2-chloropyridine-4-boronic acid, 98%, 98%, (3-Bromo-2-chloropyridin-4-yl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 100g, 5g, 250mg, 500mg, 100mg.
(3-bromo-2-chloro-4-pyridinyl)boronic acid (CAS 1072944-16-1) is a chemical compound with the molecular formula C5H4BBrClNO2 and a molecular weight of 236.26 g/mol. IUPAC name: (3-bromo-2-chloro-4-pyridinyl)boronic acid. InChIKey: FHSDUAXKXSMERY-UHFFFAOYSA-N.
| Molecular formula | C5H4BBrClNO2 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | (3-bromo-2-chloro-4-pyridinyl)boronic acid |
| InChIKey | FHSDUAXKXSMERY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=NC=C1)Cl)Br)(O)O |
Computed by PubChem (NCBI)