Products 2121511-46-2
CAS 2121511-46-2 appears in our catalog under these names: 6-Bromo-2-chloropyridine-3-boronic acid, 6-Bromo-2-chloropyridine-3-boronic acid, 95%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 1g, 5g, 10g, 250mg.
(6-bromo-2-chloro-3-pyridinyl)boronic acid (CAS 2121511-46-2) is a chemical compound with the molecular formula C5H4BBrClNO2 and a molecular weight of 236.26 g/mol. IUPAC name: (6-bromo-2-chloro-3-pyridinyl)boronic acid. InChIKey: TUOJKYPERFUOLE-UHFFFAOYSA-N.
| Molecular formula | C5H4BBrClNO2 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | (6-bromo-2-chloro-3-pyridinyl)boronic acid |
| InChIKey | TUOJKYPERFUOLE-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)Br)Cl)(O)O |
Computed by PubChem (NCBI)