cas: 874784-11-9 — see every product listed under this CAS number, including other names
2-Bromo-4,5-difluorobenzene-1-sulfonyl chloride 95% (CAS 874784-11-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A164652-100mg |
| cas | 874784-11-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 250mg | 320.31 Pln | |
| Ambeed | 1g | 542.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A164652 |
2-bromo-4,5-difluorobenzenesulfonyl chloride (CAS 874784-11-9) is a chemical compound with the molecular formula C6H2BrClF2O2S and a molecular weight of 291.50 g/mol. IUPAC name: 2-bromo-4,5-difluorobenzenesulfonyl chloride. InChIKey: RZIOWUSICQPJJF-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClF2O2S |
|---|---|
| Molecular weight | 291.50 g/mol |
| IUPAC name | 2-bromo-4,5-difluorobenzenesulfonyl chloride |
| InChIKey | RZIOWUSICQPJJF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1S(=O)(=O)Cl)Br)F)F |
Computed by PubChem (NCBI)