Products 351003-42-4

CAS 351003-42-4 appears in our catalog under these names: 2-Bromo-4,6-difluorobenzenesulfonyl chloride, 95%, 2-Bromo-4,6-difluorobenzene-1-sulfonyl chloride, 98%, 2-Bromo-4,6-difluorobenzenesulphonyl chloride. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-bromo-4,6-difluorobenzenesulfonyl chloride (CAS 351003-42-4) is a chemical compound with the molecular formula C6H2BrClF2O2S and a molecular weight of 291.50 g/mol. IUPAC name: 2-bromo-4,6-difluorobenzenesulfonyl chloride. InChIKey: LBDIILUAEZRJMW-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2BrClF2O2S
Molecular weight291.50 g/mol
IUPAC name2-bromo-4,6-difluorobenzenesulfonyl chloride
InChIKeyLBDIILUAEZRJMW-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1F)S(=O)(=O)Cl)Br)F

Computed by PubChem (NCBI)