Products 874784-11-9

CAS 874784-11-9 appears in our catalog under these names: 2-Bromo-4,5-difluorobenzenesulphonyl chloride, 98%, 2-Bromo-4,5-difluorobenzene-1-sulfonyl chloride, 98%, 2-Bromo-4,5-difluorobenzene-1-sulfonyl chloride 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

2-bromo-4,5-difluorobenzenesulfonyl chloride (CAS 874784-11-9) is a chemical compound with the molecular formula C6H2BrClF2O2S and a molecular weight of 291.50 g/mol. IUPAC name: 2-bromo-4,5-difluorobenzenesulfonyl chloride. InChIKey: RZIOWUSICQPJJF-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2BrClF2O2S
Molecular weight291.50 g/mol
IUPAC name2-bromo-4,5-difluorobenzenesulfonyl chloride
InChIKeyRZIOWUSICQPJJF-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1S(=O)(=O)Cl)Br)F)F

Computed by PubChem (NCBI)