CAS 874804-21-4 appears in our catalog under these names: 4-Bromo-2,6-difluorobenzenesulfonyl chloride, 4-Bromo-2,6-difluorobenzenesulfonyl chloride, 97%. Offered by: Biosynth, Fluorochem, Combi-blocks. Available pack sizes: 0,5g, 5g, 50mg, 100mg, 250mg, 500mg, 1g, 2.5g.
4-bromo-2,6-difluorobenzenesulfonyl chloride (CAS 874804-21-4) is a chemical compound with the molecular formula C6H2BrClF2O2S and a molecular weight of 291.50 g/mol. IUPAC name: 4-bromo-2,6-difluorobenzenesulfonyl chloride. InChIKey: UMDYPUFAKPKDSC-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClF2O2S |
|---|---|
| Molecular weight | 291.50 g/mol |
| IUPAC name | 4-bromo-2,6-difluorobenzenesulfonyl chloride |
| InChIKey | UMDYPUFAKPKDSC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)S(=O)(=O)Cl)F)Br |
Computed by PubChem (NCBI)