2-Bromo-4,6-diphenylpyrimidine, 98%
cas: 56181-49-8 — see every product listed under this CAS number, including other names
2-Bromo-4,6-diphenylpyrimidine, 98% (CAS 56181-49-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A715787-1g |
| cas | 56181-49-8 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 1138.00 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 275.60 Pln | |
| Chemat | 5g | 1086.80 Pln | |
| BLDpharm | 1g | 281.04 Pln | |
| BLDpharm | 5g | 1119.63 Pln | |
| Fluorochem | 250mg | 117.68 Pln | |
| Fluorochem | 1g | 263.47 Pln | |
| Fluorochem | 5g | 1075.68 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
2-bromo-4,6-diphenylpyrimidine (CAS 56181-49-8) is a chemical compound with the molecular formula C16H11BrN2 and a molecular weight of 311.18 g/mol. IUPAC name: 2-bromo-4,6-diphenylpyrimidine. InChIKey: GPGIIKKUKINTGW-UHFFFAOYSA-N.
| Molecular formula | C16H11BrN2 |
|---|---|
| Molecular weight | 311.18 g/mol |
| IUPAC name | 2-bromo-4,6-diphenylpyrimidine |
| InChIKey | GPGIIKKUKINTGW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC(=N2)Br)C3=CC=CC=C3 |
Computed by PubChem (NCBI)