CAS 243472-70-0 appears in our catalog under these names: 2–Bromo–5,6–Diphenylpyrazine, 5-Bromo-2,3-diphenylpyrazine 97%, 5-Bromo-2,3-diphenylpyrazine, 97%, 97%, 5-Bromo-2,3-diphenylpyrazine, 98%+,RG. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 10g, 25g.
5-bromo-2,3-diphenylpyrazine (CAS 243472-70-0) is a chemical compound with the molecular formula C16H11BrN2 and a molecular weight of 311.18 g/mol. IUPAC name: 5-bromo-2,3-diphenylpyrazine. InChIKey: UNPRTNCCXQCEEP-UHFFFAOYSA-N.
| Molecular formula | C16H11BrN2 |
|---|---|
| Molecular weight | 311.18 g/mol |
| IUPAC name | 5-bromo-2,3-diphenylpyrazine |
| InChIKey | UNPRTNCCXQCEEP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=C(N=C2C3=CC=CC=C3)Br |
Computed by PubChem (NCBI)