CAS 150239-89-7 appears in our catalog under these names: 2,2'-(5-Bromo-1,3-phenylene)dipyridine 95+%, 2,2′-(5-Bromo-1,3-phenylene)bis[pyridine], 95+%, 95+%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-(3-bromo-5-pyridin-2-ylphenyl)pyridine (CAS 150239-89-7) is a chemical compound with the molecular formula C16H11BrN2 and a molecular weight of 311.18 g/mol. IUPAC name: 2-(3-bromo-5-pyridin-2-ylphenyl)pyridine. InChIKey: WYBQKTWLOQGECX-UHFFFAOYSA-N.
| Molecular formula | C16H11BrN2 |
|---|---|
| Molecular weight | 311.18 g/mol |
| IUPAC name | 2-(3-bromo-5-pyridin-2-ylphenyl)pyridine |
| InChIKey | WYBQKTWLOQGECX-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC(=CC(=C2)Br)C3=CC=CC=N3 |
Computed by PubChem (NCBI)