CAS 361366-74-7 is the registry number for 4,4'-(5-Bromo-1,3-phenylene)dipyridine, 97%+(HPLC),RG, 97%+(HPLC),RG. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(3-bromo-5-pyridin-4-ylphenyl)pyridine (CAS 361366-74-7) is a chemical compound with the molecular formula C16H11BrN2 and a molecular weight of 311.18 g/mol. IUPAC name: 4-(3-bromo-5-pyridin-4-ylphenyl)pyridine. InChIKey: WKOOMBSRXIYXHY-UHFFFAOYSA-N.
| Molecular formula | C16H11BrN2 |
|---|---|
| Molecular weight | 311.18 g/mol |
| IUPAC name | 4-(3-bromo-5-pyridin-4-ylphenyl)pyridine |
| InChIKey | WKOOMBSRXIYXHY-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=CC(=CC(=C2)Br)C3=CC=NC=C3 |
Computed by PubChem (NCBI)