2-Bromo-4-(4-chlorophenyl)thiazole, 95%
cas: 39564-86-8 — see every product listed under this CAS number, including other names
2-Bromo-4-(4-chlorophenyl)thiazole, 95% (CAS 39564-86-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A598566-100mg |
| cas | 39564-86-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 342.56 Pln | |
| Ambeed | 250mg | 548.38 Pln | |
| Ambeed | 1g | 1349.38 Pln | |
| Ambeed | 5g | 3913.69 Pln | |
| BLDpharm | 100mg | 342.13 Pln | |
| BLDpharm | 250mg | 536.50 Pln | |
| BLDpharm | 1g | 1325.11 Pln | |
| BLDpharm | 5g | 3840.89 Pln | |
| Chemat | 100mg | 318.80 Pln | |
| Chemat | 250mg | 496.40 Pln | |
| Chemat | 1g | 1235.60 Pln | |
| Chemat | 5g | 3578.00 Pln | |
| Fluorochem | 1g | 2294.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-bromo-4-(4-chlorophenyl)-1,3-thiazole (CAS 39564-86-8) is a chemical compound with the molecular formula C9H5BrClNS and a molecular weight of 274.57 g/mol. IUPAC name: 2-bromo-4-(4-chlorophenyl)-1,3-thiazole. InChIKey: QBRGRSYZRUCWNH-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClNS |
|---|---|
| Molecular weight | 274.57 g/mol |
| IUPAC name | 2-bromo-4-(4-chlorophenyl)-1,3-thiazole |
| InChIKey | QBRGRSYZRUCWNH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC(=N2)Br)Cl |
Computed by PubChem (NCBI)