CAS 1353856-05-9 appears in our catalog under these names: 2-Bromo-5-(4-chlorophenyl)thiazole, 95+%, 2-Bromo-5-(4-chlorophenyl)-1,3-thiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-bromo-5-(4-chlorophenyl)-1,3-thiazole (CAS 1353856-05-9) is a chemical compound with the molecular formula C9H5BrClNS and a molecular weight of 274.57 g/mol. IUPAC name: 2-bromo-5-(4-chlorophenyl)-1,3-thiazole. InChIKey: XCJHIAUUWANTCW-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClNS |
|---|---|
| Molecular weight | 274.57 g/mol |
| IUPAC name | 2-bromo-5-(4-chlorophenyl)-1,3-thiazole |
| InChIKey | XCJHIAUUWANTCW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=C(S2)Br)Cl |
Computed by PubChem (NCBI)