CAS 959986-18-6 is the registry number for 5-(3-Bromophenyl)-2-chlorothiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-(3-bromophenyl)-2-chloro-1,3-thiazole (CAS 959986-18-6) is a chemical compound with the molecular formula C9H5BrClNS and a molecular weight of 274.57 g/mol. IUPAC name: 5-(3-bromophenyl)-2-chloro-1,3-thiazole. InChIKey: WWEMFLPMJMFBLI-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClNS |
|---|---|
| Molecular weight | 274.57 g/mol |
| IUPAC name | 5-(3-bromophenyl)-2-chloro-1,3-thiazole |
| InChIKey | WWEMFLPMJMFBLI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=CN=C(S2)Cl |
Computed by PubChem (NCBI)