Products 1188037-87-7
CAS 1188037-87-7 appears in our catalog under these names: 4-(3-Bromophenyl)-2-chlorothiazole 97%, 4-(3-Bromophenyl)-2-chlorothiazole, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(3-bromophenyl)-2-chloro-1,3-thiazole (CAS 1188037-87-7) is a chemical compound with the molecular formula C9H5BrClNS and a molecular weight of 274.57 g/mol. IUPAC name: 4-(3-bromophenyl)-2-chloro-1,3-thiazole. InChIKey: FGCHXDIQMZWJGA-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClNS |
|---|---|
| Molecular weight | 274.57 g/mol |
| IUPAC name | 4-(3-bromophenyl)-2-chloro-1,3-thiazole |
| InChIKey | FGCHXDIQMZWJGA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=CSC(=N2)Cl |
Computed by PubChem (NCBI)