cas: 1214337-88-8 — see every product listed under this CAS number, including other names
2-Bromo-4-(trifluoromethoxy)benzoic acid ethyl ester, ≥95%, ≥95% (CAS 1214337-88-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DDJY-1g |
| cas | 1214337-88-8 |
| size | 1g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2166.80 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-bromo-4-(trifluoromethoxy)benzoate (CAS 1214337-88-8) is a chemical compound with the molecular formula C10H8BrF3O3 and a molecular weight of 313.07 g/mol. IUPAC name: ethyl 2-bromo-4-(trifluoromethoxy)benzoate. InChIKey: KZYMJZRQLXDFIR-UHFFFAOYSA-N.
| Molecular formula | C10H8BrF3O3 |
|---|---|
| Molecular weight | 313.07 g/mol |
| IUPAC name | ethyl 2-bromo-4-(trifluoromethoxy)benzoate |
| InChIKey | KZYMJZRQLXDFIR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1)OC(F)(F)F)Br |
Computed by PubChem (NCBI)