cas: 1039744-23-4 — see every product listed under this CAS number, including other names
2-Bromo-4-fluoro-1-(methylsulfonyl)benzene 98% (CAS 1039744-23-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A177078-100mg |
| cas | 1039744-23-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 1126.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A177078 |
2-bromo-4-fluoro-1-methylsulfonylbenzene (CAS 1039744-23-4) is a chemical compound with the molecular formula C7H6BrFO2S and a molecular weight of 253.09 g/mol. IUPAC name: 2-bromo-4-fluoro-1-methylsulfonylbenzene. InChIKey: ZQSRQQAHADUCSD-UHFFFAOYSA-N.
| Molecular formula | C7H6BrFO2S |
|---|---|
| Molecular weight | 253.09 g/mol |
| IUPAC name | 2-bromo-4-fluoro-1-methylsulfonylbenzene |
| InChIKey | ZQSRQQAHADUCSD-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=C(C=C1)F)Br |
Computed by PubChem (NCBI)