cas: 2241588-89-4 — see every product listed under this CAS number, including other names
2-Bromo-4-methoxy-3-nitro-benzoic acid methyl ester, 98%, 98% (CAS 2241588-89-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch134K7O-100mg |
| cas | 2241588-89-4 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 827.60 Pln | |
| Chemat | 250mg | 1350.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-bromo-4-methoxy-3-nitrobenzoate (CAS 2241588-89-4) is a chemical compound with the molecular formula C9H8BrNO5 and a molecular weight of 290.07 g/mol. IUPAC name: methyl 2-bromo-4-methoxy-3-nitrobenzoate. InChIKey: WCOQYXUQFHIJIO-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO5 |
|---|---|
| Molecular weight | 290.07 g/mol |
| IUPAC name | methyl 2-bromo-4-methoxy-3-nitrobenzoate |
| InChIKey | WCOQYXUQFHIJIO-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C(=O)OC)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)