Products 1885103-93-4

CAS 1885103-93-4 is the registry number for 2-Bromo-4-methoxy-5-nitro-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 2-bromo-4-methoxy-5-nitrobenzoate (CAS 1885103-93-4) is a chemical compound with the molecular formula C9H8BrNO5 and a molecular weight of 290.07 g/mol. IUPAC name: methyl 2-bromo-4-methoxy-5-nitrobenzoate. InChIKey: NPXYHYKAKQZSHN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8BrNO5
Molecular weight290.07 g/mol
IUPAC namemethyl 2-bromo-4-methoxy-5-nitrobenzoate
InChIKeyNPXYHYKAKQZSHN-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C(=C1)Br)C(=O)OC)[N+](=O)[O-]

Computed by PubChem (NCBI)