CAS 40258-73-9 appears in our catalog under these names: 3-Bromo-4-methoxy-5-nitro-benzoic acid methyl ester 97%, 3-Bromo-4-methoxy-5-nitro-benzoic acid methyl ester, 97%, 97%, 3-Bromo-4-methoxy-5-nitro-benzoic acid methyl ester, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g.
Methyl 3-bromo-4-methoxy-5-nitrobenzoate (CAS 40258-73-9) is a chemical compound with the molecular formula C9H8BrNO5 and a molecular weight of 290.07 g/mol. IUPAC name: methyl 3-bromo-4-methoxy-5-nitrobenzoate. InChIKey: FTUNSACBIXMAPH-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO5 |
|---|---|
| Molecular weight | 290.07 g/mol |
| IUPAC name | methyl 3-bromo-4-methoxy-5-nitrobenzoate |
| InChIKey | FTUNSACBIXMAPH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1Br)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)