Products 56709-71-8
CAS 56709-71-8 is the registry number for Methyl 3-bromo-5-methoxy-2-nitrobenzoate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl 3-bromo-5-methoxy-2-nitrobenzoate (CAS 56709-71-8) is a chemical compound with the molecular formula C9H8BrNO5 and a molecular weight of 290.07 g/mol. IUPAC name: methyl 3-bromo-5-methoxy-2-nitrobenzoate. InChIKey: ZLRZJIJIVCWMKV-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO5 |
|---|---|
| Molecular weight | 290.07 g/mol |
| IUPAC name | methyl 3-bromo-5-methoxy-2-nitrobenzoate |
| InChIKey | ZLRZJIJIVCWMKV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)Br)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)